C28H26N2O10 — CID 14775015
[5-acetamido-4-benzoyloxy-3-hydroxy-6-(4-nitrophenoxy)oxan-2-yl]methyl benzoate (PubChem CID 14775015) has the molecular formula C28H26N2O10 and a molecular weight of 550.52 g/mol. Its IUPAC name is [5-acetamido-4-benzoyloxy-3-hydroxy-6-(4-nitrophenoxy)oxan-2-yl]methyl benzoate.
| Compound Name | [5-acetamido-4-benzoyloxy-3-hydroxy-6-(4-nitrophenoxy)oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 14775015 |
| Molecular Formula | C28H26N2O10 |
| Molecular Weight | 550.52 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | [5-acetamido-4-benzoyloxy-3-hydroxy-6-(4-nitrophenoxy)oxan-2-yl]methyl benzoate |
| SMILES | CC(=O)NC1C(Oc2ccc([N+](=O)[O-])cc2)OC(COC(=O)c2ccccc2)C(O)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H26N2O10/c1-17(31)29-23-25(40-27(34)19-10-6-3-7-11-19)24(32)22(16-37-26(33)18-8-4-2-5-9-18)39-28(23)38-21-14-12-20(13-15-21)30(35)36/h2-15,22-25,28,32H,16H2,1H3,(H,29,31) |
| InChIKey | PGMLFNAQJLVCQA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 163.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|