C31H35NO16 — CID 71307217
[(2R,3R,4S,5R,6R)-3,4-dihydroxy-6-(4-nitrophenoxy)-5-[(2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl benzoate (PubChem CID 71307217) has the molecular formula C31H35NO16 and a molecular weight of 677.61 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4-dihydroxy-6-(4-nitrophenoxy)-5-[(2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4-dihydroxy-6-(4-nitrophenoxy)-5-[(2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 71307217 |
| Molecular Formula | C31H35NO16 |
| Molecular Weight | 677.61 g/mol |
| Exact Mass | 677.20 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4-dihydroxy-6-(4-nitrophenoxy)-5-[(2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl benzoate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](O[C@H]2[C@@H](Oc3ccc([N+](=O)[O-])cc3)O[C@H](COC(=O)c3ccccc3)[C@H](O)[C@@H]2O)O[C@@H](C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C31H35NO16/c1-15-25(43-16(2)33)27(44-17(3)34)28(45-18(4)35)31(42-15)48-26-24(37)23(36)22(14-41-29(38)19-8-6-5-7-9-19)47-30(26)46-21-12-10-20(11-13-21)32(39)40/h5-13,15,22-28,30-31,36-37H,14H2,1-4H3/t15-,22+,23-,24-,25+,26+,27+,28-,30-,31+/m0/s1 |
| InChIKey | XCTRVDVYYTYELV-ODNKWTBRSA-N |
| XLogP | 1.20 |
| TPSA | 225.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.61 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|