C21H23NO8 — CID 20676533
[(2S,3S,4R,5S,6R)-4-hydroxy-2-methyl-6-(4-nitrophenoxy)-5-phenylmethoxyoxan-3-yl] acetate (PubChem CID 20676533) has the molecular formula C21H23NO8 and a molecular weight of 417.41 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6R)-4-hydroxy-2-methyl-6-(4-nitrophenoxy)-5-phenylmethoxyoxan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,5S,6R)-4-hydroxy-2-methyl-6-(4-nitrophenoxy)-5-phenylmethoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 20676533 |
| Molecular Formula | C21H23NO8 |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | [(2S,3S,4R,5S,6R)-4-hydroxy-2-methyl-6-(4-nitrophenoxy)-5-phenylmethoxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](O)[C@H](OCc2ccccc2)[C@@H](Oc2ccc([N+](=O)[O-])cc2)O[C@H]1C |
| InChI | InChI=1S/C21H23NO8/c1-13-19(29-14(2)23)18(24)20(27-12-15-6-4-3-5-7-15)21(28-13)30-17-10-8-16(9-11-17)22(25)26/h3-11,13,18-21,24H,12H2,1-2H3/t13-,18+,19+,20-,21+/m0/s1 |
| InChIKey | MLPQGVCQDLLVDY-LKDANELNSA-N |
| XLogP | 2.60 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|