C25H25NO14 — CID 154661182
methyl (2S,3S,4S,5R,6S)-4,5-diacetyloxy-3-hydroxy-6-[4-[(4-nitrophenoxy)carbonyloxymethyl]phenoxy]oxane-2-carboxylate (PubChem CID 154661182) has the molecular formula C25H25NO14 and a molecular weight of 563.47 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-4,5-diacetyloxy-3-hydroxy-6-[4-[(4-nitrophenoxy)carbonyloxymethyl]phenoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-4,5-diacetyloxy-3-hydroxy-6-[4-[(4-nitrophenoxy)carbonyloxymethyl]phenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 154661182 |
| Molecular Formula | C25H25NO14 |
| Molecular Weight | 563.47 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-4,5-diacetyloxy-3-hydroxy-6-[4-[(4-nitrophenoxy)carbonyloxymethyl]phenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc(COC(=O)Oc3ccc([N+](=O)[O-])cc3)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1O |
| InChI | InChI=1S/C25H25NO14/c1-13(27)36-20-19(29)21(23(30)34-3)40-24(22(20)37-14(2)28)38-17-8-4-15(5-9-17)12-35-25(31)39-18-10-6-16(7-11-18)26(32)33/h4-11,19-22,24,29H,12H2,1-3H3/t19-,20-,21-,22+,24+/m0/s1 |
| InChIKey | LDRDOFKVJUXFML-VZGLXOSZSA-N |
| XLogP | 1.81 |
| TPSA | 196.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.47 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|