C20H23NO11 — CID 11328481
methyl (2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-[(4-nitrophenyl)methyl]oxane-2-carboxylate (PubChem CID 11328481) has the molecular formula C20H23NO11 and a molecular weight of 453.40 g/mol. Its IUPAC name is methyl (2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-[(4-nitrophenyl)methyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-[(4-nitrophenyl)methyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 11328481 |
| Molecular Formula | C20H23NO11 |
| Molecular Weight | 453.40 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | methyl (2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-[(4-nitrophenyl)methyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Cc2ccc([N+](=O)[O-])cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H23NO11/c1-10(22)29-16-15(9-13-5-7-14(8-6-13)21(26)27)32-19(20(25)28-4)18(31-12(3)24)17(16)30-11(2)23/h5-8,15-19H,9H2,1-4H3/t15-,16-,17+,18-,19-/m0/s1 |
| InChIKey | DYEWJYOPRXQKBI-OYSTVDSJSA-N |
| XLogP | 0.87 |
| TPSA | 157.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.40 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|