C21H25BrO9 — CID 132937772
methyl (2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-[[4-(bromomethyl)phenyl]methyl]oxane-2-carboxylate (PubChem CID 132937772) has the molecular formula C21H25BrO9 and a molecular weight of 501.33 g/mol. Its IUPAC name is methyl (2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-[[4-(bromomethyl)phenyl]methyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-[[4-(bromomethyl)phenyl]methyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 132937772 |
| Molecular Formula | C21H25BrO9 |
| Molecular Weight | 501.33 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | methyl (2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-[[4-(bromomethyl)phenyl]methyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Cc2ccc(CBr)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H25BrO9/c1-11(23)28-17-16(9-14-5-7-15(10-22)8-6-14)31-20(21(26)27-4)19(30-13(3)25)18(17)29-12(2)24/h5-8,16-20H,9-10H2,1-4H3/t16-,17-,18+,19-,20-/m0/s1 |
| InChIKey | QKFLQTIQEZBAAA-KNJMJIDISA-N |
| XLogP | 1.86 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|