C13H17BO9 — CID 174083964
CID 174083964 (PubChem CID 174083964) has the molecular formula C13H17BO9 and a molecular weight of 328.08 g/mol.
| Compound Name | CID 174083964 |
|---|---|
| PubChem CID | 174083964 |
| Molecular Formula | C13H17BO9 |
| Molecular Weight | 328.08 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | — |
| SMILES | [B][C@H]1O[C@H](C(=O)OC)[C@@H](OC(C)=O)C(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C13H17BO9/c1-5(15)20-8-9(21-6(2)16)11(13(18)19-4)23-12(14)10(8)22-7(3)17/h8-12H,1-4H3/t8?,9-,10+,11-,12-/m0/s1 |
| InChIKey | YRIDWZVSVQHELS-YAXHFPQCSA-N |
| XLogP | -1.15 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.08 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|