C13H20O9 — CID 537948
methyl 3,4-diacetyloxy-5,6-dimethoxyoxane-2-carboxylate (PubChem CID 537948) has the molecular formula C13H20O9 and a molecular weight of 320.29 g/mol. Its IUPAC name is methyl 3,4-diacetyloxy-5,6-dimethoxyoxane-2-carboxylate.
| Compound Name | methyl 3,4-diacetyloxy-5,6-dimethoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 537948 |
| Molecular Formula | C13H20O9 |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | methyl 3,4-diacetyloxy-5,6-dimethoxyoxane-2-carboxylate |
| SMILES | COC(=O)C1OC(OC)C(OC)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C13H20O9/c1-6(14)20-8-9(21-7(2)15)11(17-3)13(19-5)22-10(8)12(16)18-4/h8-11,13H,1-5H3 |
| InChIKey | HDKUIXGSGHABHW-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|