C27H36O19 — CID 168814831
methyl (3S,4S,5R)-3,4,5-triacetyloxy-6-[[(2R,3S,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxan-2-yl]methoxy]oxane-2-carboxylate (PubChem CID 168814831) has the molecular formula C27H36O19 and a molecular weight of 664.57 g/mol. Its IUPAC name is methyl (3S,4S,5R)-3,4,5-triacetyloxy-6-[[(2R,3S,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxan-2-yl]methoxy]oxane-2-carboxylate.
| Compound Name | methyl (3S,4S,5R)-3,4,5-triacetyloxy-6-[[(2R,3S,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxan-2-yl]methoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 168814831 |
| Molecular Formula | C27H36O19 |
| Molecular Weight | 664.57 g/mol |
| Exact Mass | 664.19 |
| IUPAC Name | methyl (3S,4S,5R)-3,4,5-triacetyloxy-6-[[(2R,3S,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxan-2-yl]methoxy]oxane-2-carboxylate |
| SMILES | COC(=O)C1OC(OC[C@H]2O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]2OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H36O19/c1-10(28)38-18-17(45-27(44-16(7)34)24(43-15(6)33)19(18)39-11(2)29)9-37-26-23(42-14(5)32)21(41-13(4)31)20(40-12(3)30)22(46-26)25(35)36-8/h17-24,26-27H,9H2,1-8H3/t17-,18+,19+,20+,21+,22?,23-,24-,26?,27-/m1/s1 |
| InChIKey | ZWYFLRUKOVCALH-AGQXCULPSA-N |
| XLogP | -1.22 |
| TPSA | 238.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.57 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|