methyl (2S,5S)-3,4,5-triacetyloxyoxolane-2-carboxylate

C12H16O9 — CID 131700717

IUPACmethyl (2S,5S)-3,4,5-triacetyloxyoxolane-2-carboxylate
SMILESCOC(=O)[C@H]1O[C@@H](OC(C)=O)C(OC(C)=O)C1OC(C)=O
InChIInChI=1S/C12H16O9/c1-5(13)18-8-9(11(16)17-4)21-12(20-7(3)15)10(8)19-6(2)14/h8-10,12H,1-4H3/t8?,9-,10?,12+/m0/s1
InChIKeyWKPDVIUFXMUXNU-RVOVVPELSA-N
MW304.25 g/mol
LogP-0.69
Rot. Bonds4

About methyl (2S,5S)-3,4,5-triacetyloxyoxolane-2-carboxylate

methyl (2S,5S)-3,4,5-triacetyloxyoxolane-2-carboxylate (PubChem CID 131700717) has the molecular formula C12H16O9 and a molecular weight of 304.25 g/mol. Its IUPAC name is methyl (2S,5S)-3,4,5-triacetyloxyoxolane-2-carboxylate.

Molecular Properties

Compound Namemethyl (2S,5S)-3,4,5-triacetyloxyoxolane-2-carboxylate
PubChem CID131700717
Molecular FormulaC12H16O9
Molecular Weight304.25 g/mol
Exact Mass304.08
IUPAC Namemethyl (2S,5S)-3,4,5-triacetyloxyoxolane-2-carboxylate
SMILESCOC(=O)[C@H]1O[C@@H](OC(C)=O)C(OC(C)=O)C1OC(C)=O
InChIInChI=1S/C12H16O9/c1-5(13)18-8-9(11(16)17-4)21-12(20-7(3)15)10(8)19-6(2)14/h8-10,12H,1-4H3/t8?,9-,10?,12+/m0/s1
InChIKeyWKPDVIUFXMUXNU-RVOVVPELSA-N
XLogP-0.69
TPSA114.43 Ų
H-Bond Donors
H-Bond Acceptors9
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.25
LogP ≤ 5-0.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 109

Computed Properties (RDKit)

Structural Alerts{'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}

Analyze methyl (2S,5S)-3,4,5-triacetyloxyoxolane-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S,5S)-3,4,5-triacetyloxyoxolane-2-carboxylate?
The IUPAC name of methyl (2S,5S)-3,4,5-triacetyloxyoxolane-2-carboxylate (CID 131700717) is methyl (2S,5S)-3,4,5-triacetyloxyoxolane-2-carboxylate.
What is the SMILES notation for methyl (2S,5S)-3,4,5-triacetyloxyoxolane-2-carboxylate?
The canonical SMILES for methyl (2S,5S)-3,4,5-triacetyloxyoxolane-2-carboxylate is COC(=O)[C@H]1O[C@@H](OC(C)=O)C(OC(C)=O)C1OC(C)=O.
What is the InChIKey of methyl (2S,5S)-3,4,5-triacetyloxyoxolane-2-carboxylate?
The InChIKey is WKPDVIUFXMUXNU-RVOVVPELSA-N. The full InChI is InChI=1S/C12H16O9/c1-5(13)18-8-9(11(16)17-4)21-12(20-7(3)15)10(8)19-6(2)14/h8-10,12H,1-4H3/t8?,9-,10?,12+/m0/s1.
What are the key properties of methyl (2S,5S)-3,4,5-triacetyloxyoxolane-2-carboxylate?
methyl (2S,5S)-3,4,5-triacetyloxyoxolane-2-carboxylate has a molecular weight of 304.25 g/mol, XLogP of -0.69, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,5S)-3,4,5-triacetyloxyoxolane-2-carboxylate is sourced from PubChem (CID 131700717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).