C17H19NO11 — CID 123719605
methyl 3,4,5-triacetyloxy-6-(2-isocyanoprop-2-enoyloxy)oxane-2-carboxylate (PubChem CID 123719605) has the molecular formula C17H19NO11 and a molecular weight of 413.34 g/mol. Its IUPAC name is methyl 3,4,5-triacetyloxy-6-(2-isocyanoprop-2-enoyloxy)oxane-2-carboxylate.
| Compound Name | methyl 3,4,5-triacetyloxy-6-(2-isocyanoprop-2-enoyloxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 123719605 |
| Molecular Formula | C17H19NO11 |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | methyl 3,4,5-triacetyloxy-6-(2-isocyanoprop-2-enoyloxy)oxane-2-carboxylate |
| SMILES | [C-]#[N+]C(=C)C(=O)OC1OC(C(=O)OC)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C17H19NO11/c1-7(18-5)15(22)29-17-14(27-10(4)21)12(26-9(3)20)11(25-8(2)19)13(28-17)16(23)24-6/h11-14,17H,1H2,2-4,6H3 |
| InChIKey | NUVGGCSVDGEMLP-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 145.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|