C15H18Cl3NO10 — CID 67984488
methyl (2S,3S,4S,5R,6R)-4,5,6-triacetyloxy-3-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate (PubChem CID 67984488) has the molecular formula C15H18Cl3NO10 and a molecular weight of 478.67 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6R)-4,5,6-triacetyloxy-3-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6R)-4,5,6-triacetyloxy-3-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 67984488 |
| Molecular Formula | C15H18Cl3NO10 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 477.00 |
| IUPAC Name | methyl (2S,3S,4S,5R,6R)-4,5,6-triacetyloxy-3-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate |
| SMILES | [H]/N=C(/O[C@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)O[C@@H]1C(=O)OC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H18Cl3NO10/c1-5(20)25-9-8(29-14(19)15(16,17)18)10(12(23)24-4)28-13(27-7(3)22)11(9)26-6(2)21/h8-11,13,19H,1-4H3/b19-14+/t8-,9-,10-,11+,13-/m0/s1 |
| InChIKey | XBAWLXWZVGTIDH-FDRBMTJCSA-N |
| XLogP | 1.04 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|