C13H18Cl3NO6 — CID 58510006
methyl (3R,4S)-5-acetyloxy-3,4-dimethyl-6-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate (PubChem CID 58510006) has the molecular formula C13H18Cl3NO6 and a molecular weight of 390.65 g/mol. Its IUPAC name is methyl (3R,4S)-5-acetyloxy-3,4-dimethyl-6-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate.
| Compound Name | methyl (3R,4S)-5-acetyloxy-3,4-dimethyl-6-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 58510006 |
| Molecular Formula | C13H18Cl3NO6 |
| Molecular Weight | 390.65 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | methyl (3R,4S)-5-acetyloxy-3,4-dimethyl-6-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate |
| SMILES | [H]/N=C(/OC1OC(C(=O)OC)[C@H](C)[C@H](C)C1OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H18Cl3NO6/c1-5-6(2)9(21-7(3)18)11(22-8(5)10(19)20-4)23-12(17)13(14,15)16/h5-6,8-9,11,17H,1-4H3/b17-12+/t5-,6+,8?,9?,11?/m1/s1 |
| InChIKey | SJUTZCOPCVNZIC-DKGNRDDKSA-N |
| XLogP | 2.45 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.65 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|