C19H30Cl3NO6 — CID 163972388
methyl (3S,5S,6R)-3,5-dimethyl-6-(2,2,2-trichloroethanimidoyl)oxy-4-[(2R,3S,5S)-3,4,5-trimethyloxan-2-yl]oxyoxane-2-carboxylate (PubChem CID 163972388) has the molecular formula C19H30Cl3NO6 and a molecular weight of 474.81 g/mol. Its IUPAC name is methyl (3S,5S,6R)-3,5-dimethyl-6-(2,2,2-trichloroethanimidoyl)oxy-4-[(2R,3S,5S)-3,4,5-trimethyloxan-2-yl]oxyoxane-2-carboxylate.
| Compound Name | methyl (3S,5S,6R)-3,5-dimethyl-6-(2,2,2-trichloroethanimidoyl)oxy-4-[(2R,3S,5S)-3,4,5-trimethyloxan-2-yl]oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 163972388 |
| Molecular Formula | C19H30Cl3NO6 |
| Molecular Weight | 474.81 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | methyl (3S,5S,6R)-3,5-dimethyl-6-(2,2,2-trichloroethanimidoyl)oxy-4-[(2R,3S,5S)-3,4,5-trimethyloxan-2-yl]oxyoxane-2-carboxylate |
| SMILES | [H]/N=C(/O[C@H]1OC(C(=O)OC)[C@@H](C)C(O[C@H]2OC[C@@H](C)C(C)[C@@H]2C)[C@@H]1C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H30Cl3NO6/c1-8-7-26-16(10(3)9(8)2)27-13-11(4)14(15(24)25-6)28-17(12(13)5)29-18(23)19(20,21)22/h8-14,16-17,23H,7H2,1-6H3/b23-18+/t8-,9?,10+,11+,12+,13?,14?,16-,17-/m1/s1 |
| InChIKey | SRCYEXQDJQOWKC-BZLOWTRXSA-N |
| XLogP | 4.17 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.81 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|