C12H18O9 — CID 102262455
methyl (2S,3S,4S,5R,6R)-5,6-diacetyloxy-3-hydroxy-4-methoxyoxane-2-carboxylate (PubChem CID 102262455) has the molecular formula C12H18O9 and a molecular weight of 306.27 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6R)-5,6-diacetyloxy-3-hydroxy-4-methoxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6R)-5,6-diacetyloxy-3-hydroxy-4-methoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 102262455 |
| Molecular Formula | C12H18O9 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | methyl (2S,3S,4S,5R,6R)-5,6-diacetyloxy-3-hydroxy-4-methoxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC)[C@@H]1O |
| InChI | InChI=1S/C12H18O9/c1-5(13)19-10-8(17-3)7(15)9(11(16)18-4)21-12(10)20-6(2)14/h7-10,12,15H,1-4H3/t7-,8-,9-,10+,12-/m0/s1 |
| InChIKey | GUKYIZVZDDXAHN-GBVMLCMLSA-N |
| XLogP | -1.25 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|