C13H18O10 — CID 14077890
methyl 3,4,5-triacetyloxy-6-hydroxyoxane-2-carboxylate (PubChem CID 14077890) has the molecular formula C13H18O10 and a molecular weight of 334.28 g/mol. Its IUPAC name is methyl 3,4,5-triacetyloxy-6-hydroxyoxane-2-carboxylate.
| Compound Name | methyl 3,4,5-triacetyloxy-6-hydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 14077890 |
| Molecular Formula | C13H18O10 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | methyl 3,4,5-triacetyloxy-6-hydroxyoxane-2-carboxylate |
| SMILES | COC(=O)C1OC(O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C13H18O10/c1-5(14)20-8-9(21-6(2)15)11(22-7(3)16)13(18)23-10(8)12(17)19-4/h8-11,13,18H,1-4H3 |
| InChIKey | CLHFNXQWJBTGBL-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|