C12H18O8 — CID 129095023
[(3S,6R)-4,5-diacetyloxy-6-hydroxy-2-methyloxan-3-yl] acetate (PubChem CID 129095023) has the molecular formula C12H18O8 and a molecular weight of 290.27 g/mol. Its IUPAC name is [(3S,6R)-4,5-diacetyloxy-6-hydroxy-2-methyloxan-3-yl] acetate.
| Compound Name | [(3S,6R)-4,5-diacetyloxy-6-hydroxy-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 129095023 |
| Molecular Formula | C12H18O8 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | [(3S,6R)-4,5-diacetyloxy-6-hydroxy-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(OC(C)=O)[C@H](O)OC(C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C12H18O8/c1-5-9(18-6(2)13)10(19-7(3)14)11(12(16)17-5)20-8(4)15/h5,9-12,16H,1-4H3/t5?,9-,10?,11?,12+/m0/s1 |
| InChIKey | QHOCNNVTMIFDFP-ZVPKIOOISA-N |
| XLogP | -0.48 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|