C11H16O9 — CID 134938300
[(2S,3S,4R,5R)-4-acetyloxy-5-carboxyoxy-6-hydroxy-2-methyloxan-3-yl] acetate (PubChem CID 134938300) has the molecular formula C11H16O9 and a molecular weight of 292.24 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-4-acetyloxy-5-carboxyoxy-6-hydroxy-2-methyloxan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,5R)-4-acetyloxy-5-carboxyoxy-6-hydroxy-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 134938300 |
| Molecular Formula | C11H16O9 |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | [(2S,3S,4R,5R)-4-acetyloxy-5-carboxyoxy-6-hydroxy-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@H](OC(=O)O)C(O)O[C@H]1C |
| InChI | InChI=1S/C11H16O9/c1-4-7(18-5(2)12)8(19-6(3)13)9(10(14)17-4)20-11(15)16/h4,7-10,14H,1-3H3,(H,15,16)/t4-,7-,8+,9+,10?/m0/s1 |
| InChIKey | WFKUROXYXUCRMU-DUOHCREOSA-N |
| XLogP | -0.35 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|