methyl (2S)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate

C13H17BrO9 — CID 129175447

IUPACmethyl (2S)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate
SMILESCOC(=O)[C@H]1OC(Br)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O
InChIInChI=1S/C13H17BrO9/c1-5(15)20-8-9(21-6(2)16)11(13(18)19-4)23-12(14)10(8)22-7(3)17/h8-12H,1-4H3/t8?,9?,10?,11-,12?/m0/s1
InChIKeyGWTNLHGTLIBHHZ-CRCJWISWSA-N
MW397.17 g/mol
LogP0.07
Rot. Bonds4

About methyl (2S)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate

methyl (2S)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate (PubChem CID 129175447) has the molecular formula C13H17BrO9 and a molecular weight of 397.17 g/mol. Its IUPAC name is methyl (2S)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate.

Molecular Properties

Compound Namemethyl (2S)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate
PubChem CID129175447
Molecular FormulaC13H17BrO9
Molecular Weight397.17 g/mol
Exact Mass396.01
IUPAC Namemethyl (2S)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate
SMILESCOC(=O)[C@H]1OC(Br)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O
InChIInChI=1S/C13H17BrO9/c1-5(15)20-8-9(21-6(2)16)11(13(18)19-4)23-12(14)10(8)22-7(3)17/h8-12H,1-4H3/t8?,9?,10?,11-,12?/m0/s1
InChIKeyGWTNLHGTLIBHHZ-CRCJWISWSA-N
XLogP0.07
TPSA114.43 Ų
H-Bond Donors
H-Bond Acceptors9
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500397.17
LogP ≤ 50.07
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 109

Computed Properties (RDKit)

Structural Alerts{'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze methyl (2S)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate?
The IUPAC name of methyl (2S)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate (CID 129175447) is methyl (2S)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate.
What is the SMILES notation for methyl (2S)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate?
The canonical SMILES for methyl (2S)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate is COC(=O)[C@H]1OC(Br)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O.
What is the InChIKey of methyl (2S)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate?
The InChIKey is GWTNLHGTLIBHHZ-CRCJWISWSA-N. The full InChI is InChI=1S/C13H17BrO9/c1-5(15)20-8-9(21-6(2)16)11(13(18)19-4)23-12(14)10(8)22-7(3)17/h8-12H,1-4H3/t8?,9?,10?,11-,12?/m0/s1.
What are the key properties of methyl (2S)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate?
methyl (2S)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate has a molecular weight of 397.17 g/mol, XLogP of 0.07, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate is sourced from PubChem (CID 129175447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).