C22H35BrO9 — CID 11466587
methyl (2R,3R,4R,5S,6S)-6-bromo-3,4,5-tris(2,2-dimethylpropanoyloxy)oxane-2-carboxylate (PubChem CID 11466587) has the molecular formula C22H35BrO9 and a molecular weight of 523.42 g/mol. Its IUPAC name is methyl (2R,3R,4R,5S,6S)-6-bromo-3,4,5-tris(2,2-dimethylpropanoyloxy)oxane-2-carboxylate.
| Compound Name | methyl (2R,3R,4R,5S,6S)-6-bromo-3,4,5-tris(2,2-dimethylpropanoyloxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 11466587 |
| Molecular Formula | C22H35BrO9 |
| Molecular Weight | 523.42 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | methyl (2R,3R,4R,5S,6S)-6-bromo-3,4,5-tris(2,2-dimethylpropanoyloxy)oxane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@@H](Br)[C@@H](OC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C22H35BrO9/c1-20(2,3)17(25)30-11-12(31-18(26)21(4,5)6)14(16(24)28-10)29-15(23)13(11)32-19(27)22(7,8)9/h11-15H,1-10H3/t11-,12-,13+,14-,15-/m1/s1 |
| InChIKey | GLAKMLRVJQHZBU-UXXRCYHCSA-N |
| XLogP | 3.15 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|