C28H40O9S — CID 11467013
methyl (2S,3S,4S,5R,6S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-phenylsulfanyloxane-2-carboxylate (PubChem CID 11467013) has the molecular formula C28H40O9S and a molecular weight of 552.69 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-phenylsulfanyloxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-phenylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 11467013 |
| Molecular Formula | C28H40O9S |
| Molecular Weight | 552.69 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-phenylsulfanyloxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Sc2ccccc2)[C@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C28H40O9S/c1-26(2,3)23(30)35-17-18(36-24(31)27(4,5)6)20(37-25(32)28(7,8)9)22(34-19(17)21(29)33-10)38-16-14-12-11-13-15-16/h11-15,17-20,22H,1-10H3/t17-,18-,19-,20+,22-/m0/s1 |
| InChIKey | POVKXESLIZQQEW-UERWRGBPSA-N |
| XLogP | 4.55 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.69 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|