C27H34O6S — CID 11730623
[(2S,3R,4S,5S,6R)-5-hydroxy-6-(phenylmethoxymethyl)-2-phenylsulfanyl-4-prop-2-enoxyoxan-3-yl] 2,2-dimethylpropanoate (PubChem CID 11730623) has the molecular formula C27H34O6S and a molecular weight of 486.63 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-5-hydroxy-6-(phenylmethoxymethyl)-2-phenylsulfanyl-4-prop-2-enoxyoxan-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,3R,4S,5S,6R)-5-hydroxy-6-(phenylmethoxymethyl)-2-phenylsulfanyl-4-prop-2-enoxyoxan-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11730623 |
| Molecular Formula | C27H34O6S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-5-hydroxy-6-(phenylmethoxymethyl)-2-phenylsulfanyl-4-prop-2-enoxyoxan-3-yl] 2,2-dimethylpropanoate |
| SMILES | C=CCO[C@H]1[C@@H](O)[C@@H](COCc2ccccc2)O[C@@H](Sc2ccccc2)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C27H34O6S/c1-5-16-31-23-22(28)21(18-30-17-19-12-8-6-9-13-19)32-25(34-20-14-10-7-11-15-20)24(23)33-26(29)27(2,3)4/h5-15,21-25,28H,1,16-18H2,2-4H3/t21-,22+,23+,24-,25+/m1/s1 |
| InChIKey | BMDTUNCSPRLZIM-MQZWXTIWSA-N |
| XLogP | 4.61 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|