C26H34O7 — CID 102271709
[(2R,3R,4S,5R,6R)-5-hydroxy-2-methoxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl] 2,2-dimethylpropanoate (PubChem CID 102271709) has the molecular formula C26H34O7 and a molecular weight of 458.55 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-5-hydroxy-2-methoxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5R,6R)-5-hydroxy-2-methoxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102271709 |
| Molecular Formula | C26H34O7 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-5-hydroxy-2-methoxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl] 2,2-dimethylpropanoate |
| SMILES | CO[C@@H]1O[C@H](COCc2ccccc2)[C@@H](O)[C@H](OCc2ccccc2)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C26H34O7/c1-26(2,3)25(28)33-23-22(31-16-19-13-9-6-10-14-19)21(27)20(32-24(23)29-4)17-30-15-18-11-7-5-8-12-18/h5-14,20-24,27H,15-17H2,1-4H3/t20-,21-,22+,23-,24-/m1/s1 |
| InChIKey | RMSPVZUPEWCVFR-GNADVCDUSA-N |
| XLogP | 3.48 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |