C34H42O8 — CID 10962896
tert-butyl 5-[[(2R,3R,4S,5R,6S)-3-hydroxy-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]methoxymethyl]-2-methylbenzoate (PubChem CID 10962896) has the molecular formula C34H42O8 and a molecular weight of 578.70 g/mol. Its IUPAC name is tert-butyl 5-[[(2R,3R,4S,5R,6S)-3-hydroxy-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]methoxymethyl]-2-methylbenzoate.
| Compound Name | tert-butyl 5-[[(2R,3R,4S,5R,6S)-3-hydroxy-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]methoxymethyl]-2-methylbenzoate |
|---|---|
| PubChem CID | 10962896 |
| Molecular Formula | C34H42O8 |
| Molecular Weight | 578.70 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | tert-butyl 5-[[(2R,3R,4S,5R,6S)-3-hydroxy-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]methoxymethyl]-2-methylbenzoate |
| SMILES | CO[C@H]1O[C@H](COCc2ccc(C)c(C(=O)OC(C)(C)C)c2)[C@@H](O)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H42O8/c1-23-16-17-26(18-27(23)32(36)42-34(2,3)4)19-38-22-28-29(35)30(39-20-24-12-8-6-9-13-24)31(33(37-5)41-28)40-21-25-14-10-7-11-15-25/h6-18,28-31,33,35H,19-22H2,1-5H3/t28-,29-,30+,31-,33+/m1/s1 |
| InChIKey | OBOMIDAXGTWJHW-PAGFLGSUSA-N |
| XLogP | 5.37 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.70 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |