C15H22O6 — CID 101366897
(2R,3R,4R,5R)-5-methoxy-4-(methoxymethoxy)-2-(phenylmethoxymethyl)oxolan-3-ol (PubChem CID 101366897) has the molecular formula C15H22O6 and a molecular weight of 298.33 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-methoxy-4-(methoxymethoxy)-2-(phenylmethoxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-5-methoxy-4-(methoxymethoxy)-2-(phenylmethoxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 101366897 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (2R,3R,4R,5R)-5-methoxy-4-(methoxymethoxy)-2-(phenylmethoxymethyl)oxolan-3-ol |
| SMILES | COCO[C@H]1[C@H](OC)O[C@H](COCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C15H22O6/c1-17-10-20-14-13(16)12(21-15(14)18-2)9-19-8-11-6-4-3-5-7-11/h3-7,12-16H,8-10H2,1-2H3/t12-,13-,14-,15-/m1/s1 |
| InChIKey | PJAAFRPOWJHBHW-KBUPBQIOSA-N |
| XLogP | 0.92 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|