C13H18O5 — CID 11139675
(2R,3S,4S,5R)-2-methoxy-5-(phenylmethoxymethyl)oxolane-3,4-diol (PubChem CID 11139675) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-methoxy-5-(phenylmethoxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-2-methoxy-5-(phenylmethoxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 11139675 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (2R,3S,4S,5R)-2-methoxy-5-(phenylmethoxymethyl)oxolane-3,4-diol |
| SMILES | CO[C@@H]1O[C@H](COCc2ccccc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H18O5/c1-16-13-12(15)11(14)10(18-13)8-17-7-9-5-3-2-4-6-9/h2-6,10-15H,7-8H2,1H3/t10-,11-,12+,13-/m1/s1 |
| InChIKey | PVICVBVWLIVOKF-FVCCEPFGSA-N |
| XLogP | 0.30 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |