C15H22O6 — CID 22979812
(2S,3R,4S,5R,6R)-3,4-dimethoxy-6-(phenylmethoxymethyl)oxane-2,5-diol (PubChem CID 22979812) has the molecular formula C15H22O6 and a molecular weight of 298.33 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-3,4-dimethoxy-6-(phenylmethoxymethyl)oxane-2,5-diol.
| Compound Name | (2S,3R,4S,5R,6R)-3,4-dimethoxy-6-(phenylmethoxymethyl)oxane-2,5-diol |
|---|---|
| PubChem CID | 22979812 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (2S,3R,4S,5R,6R)-3,4-dimethoxy-6-(phenylmethoxymethyl)oxane-2,5-diol |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](O)[C@@H](COCc2ccccc2)O[C@@H]1O |
| InChI | InChI=1S/C15H22O6/c1-18-13-12(16)11(21-15(17)14(13)19-2)9-20-8-10-6-4-3-5-7-10/h3-7,11-17H,8-9H2,1-2H3/t11-,12-,13+,14-,15+/m1/s1 |
| InChIKey | JFQWXKAHKANPPX-QMIVOQANSA-N |
| XLogP | 0.31 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |