C28H34O5Si — CID 101473888
(3S,4R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-5-(phenylmethoxymethyl)oxolane-2,4-diol (PubChem CID 101473888) has the molecular formula C28H34O5Si and a molecular weight of 478.66 g/mol. Its IUPAC name is (3S,4R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-5-(phenylmethoxymethyl)oxolane-2,4-diol.
| Compound Name | (3S,4R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-5-(phenylmethoxymethyl)oxolane-2,4-diol |
|---|---|
| PubChem CID | 101473888 |
| Molecular Formula | C28H34O5Si |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | (3S,4R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-5-(phenylmethoxymethyl)oxolane-2,4-diol |
| SMILES | CC(C)(C)[Si](O[C@@H]1C(O)O[C@H](COCc2ccccc2)[C@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H34O5Si/c1-28(2,3)34(22-15-9-5-10-16-22,23-17-11-6-12-18-23)33-26-25(29)24(32-27(26)30)20-31-19-21-13-7-4-8-14-21/h4-18,24-27,29-30H,19-20H2,1-3H3/t24-,25-,26+,27?/m1/s1 |
| InChIKey | JTIJJTZMULDWIJ-WFZAHQNKSA-N |
| XLogP | 3.23 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|