C35H40O5Si — CID 171122175
(3R,4S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-ol (PubChem CID 171122175) has the molecular formula C35H40O5Si and a molecular weight of 568.79 g/mol. Its IUPAC name is (3R,4S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-ol.
| Compound Name | (3R,4S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-ol |
|---|---|
| PubChem CID | 171122175 |
| Molecular Formula | C35H40O5Si |
| Molecular Weight | 568.79 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | (3R,4S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-ol |
| SMILES | CC(C)(C)[Si](O[C@H]1C(O)O[C@H](COCc2ccccc2)[C@@H]1OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H40O5Si/c1-35(2,3)41(29-20-12-6-13-21-29,30-22-14-7-15-23-30)40-33-32(38-25-28-18-10-5-11-19-28)31(39-34(33)36)26-37-24-27-16-8-4-9-17-27/h4-23,31-34,36H,24-26H2,1-3H3/t31-,32+,33-,34?/m1/s1 |
| InChIKey | ZQPVAPFASYXRHD-KOANPKMSSA-N |
| XLogP | 5.45 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.79 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|