C29H36O6Si — CID 171125092
(2S,3S,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylmethoxyoxane-2,3,4-triol (PubChem CID 171125092) has the molecular formula C29H36O6Si and a molecular weight of 508.69 g/mol. Its IUPAC name is (2S,3S,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylmethoxyoxane-2,3,4-triol.
| Compound Name | (2S,3S,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylmethoxyoxane-2,3,4-triol |
|---|---|
| PubChem CID | 171125092 |
| Molecular Formula | C29H36O6Si |
| Molecular Weight | 508.69 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | (2S,3S,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylmethoxyoxane-2,3,4-triol |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H36O6Si/c1-29(2,3)36(22-15-9-5-10-16-22,23-17-11-6-12-18-23)34-20-24-27(25(30)26(31)28(32)35-24)33-19-21-13-7-4-8-14-21/h4-18,24-28,30-32H,19-20H2,1-3H3/t24-,25-,26+,27-,28+/m1/s1 |
| InChIKey | ZRSVNQIEWGHTPT-DFLSAPQXSA-N |
| XLogP | 2.59 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.69 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|