C45H54O6Si2 — CID 164669991
(3R,6R)-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-2-(hydroxymethyl)-6-phenylmethoxyoxan-4-ol (PubChem CID 164669991) has the molecular formula C45H54O6Si2 and a molecular weight of 747.09 g/mol. Its IUPAC name is (3R,6R)-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-2-(hydroxymethyl)-6-phenylmethoxyoxan-4-ol.
| Compound Name | (3R,6R)-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-2-(hydroxymethyl)-6-phenylmethoxyoxan-4-ol |
|---|---|
| PubChem CID | 164669991 |
| Molecular Formula | C45H54O6Si2 |
| Molecular Weight | 747.09 g/mol |
| Exact Mass | 746.35 |
| IUPAC Name | (3R,6R)-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-2-(hydroxymethyl)-6-phenylmethoxyoxan-4-ol |
| SMILES | CC(C)(C)[Si](OC1C(O)[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(CO)O[C@H]1OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H54O6Si2/c1-44(2,3)52(35-24-14-8-15-25-35,36-26-16-9-17-27-36)50-41-39(32-46)49-43(48-33-34-22-12-7-13-23-34)42(40(41)47)51-53(45(4,5)6,37-28-18-10-19-29-37)38-30-20-11-21-31-38/h7-31,39-43,46-47H,32-33H2,1-6H3/t39?,40?,41-,42?,43+/m0/s1 |
| InChIKey | PROKHAOOKLXKLM-CGIBAWEYSA-N |
| XLogP | 6.17 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.09 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|