C22H30O6Si — CID 10811969
(3S,4S,5S,6S)-3-[tert-butyl(diphenyl)silyl]oxy-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 10811969) has the molecular formula C22H30O6Si and a molecular weight of 418.56 g/mol. Its IUPAC name is (3S,4S,5S,6S)-3-[tert-butyl(diphenyl)silyl]oxy-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (3S,4S,5S,6S)-3-[tert-butyl(diphenyl)silyl]oxy-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 10811969 |
| Molecular Formula | C22H30O6Si |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (3S,4S,5S,6S)-3-[tert-butyl(diphenyl)silyl]oxy-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | CC(C)(C)[Si](O[C@@H]1C(O)O[C@@H](CO)[C@@H](O)[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30O6Si/c1-22(2,3)29(15-10-6-4-7-11-15,16-12-8-5-9-13-16)28-20-19(25)18(24)17(14-23)27-21(20)26/h4-13,17-21,23-26H,14H2,1-3H3/t17-,18+,19-,20-,21?/m0/s1 |
| InChIKey | WXIONDGKQQUIGZ-MLVLIFOTSA-N |
| XLogP | 0.36 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|