C27H32O3Si — CID 102433801
(3S,4R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-phenyloxolan-2-ol (PubChem CID 102433801) has the molecular formula C27H32O3Si and a molecular weight of 432.64 g/mol. Its IUPAC name is (3S,4R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-phenyloxolan-2-ol.
| Compound Name | (3S,4R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-phenyloxolan-2-ol |
|---|---|
| PubChem CID | 102433801 |
| Molecular Formula | C27H32O3Si |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | (3S,4R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-phenyloxolan-2-ol |
| SMILES | C[C@H]1[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(O)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C27H32O3Si/c1-20-24(21-14-8-5-9-15-21)29-26(28)25(20)30-31(27(2,3)4,22-16-10-6-11-17-22)23-18-12-7-13-19-23/h5-20,24-26,28H,1-4H3/t20-,24-,25+,26?/m1/s1 |
| InChIKey | VDCATAIRYYCAPC-SLPRKMDESA-N |
| XLogP | 4.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|