C42H44O4SeSi — CID 102217004
(2S,3S,4aS,5S,6S,7S,8aS)-5-[tert-butyl(diphenyl)silyl]oxy-2,3-diphenyl-7-phenylselanyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-6-ol (PubChem CID 102217004) has the molecular formula C42H44O4SeSi and a molecular weight of 719.86 g/mol. Its IUPAC name is (2S,3S,4aS,5S,6S,7S,8aS)-5-[tert-butyl(diphenyl)silyl]oxy-2,3-diphenyl-7-phenylselanyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-6-ol.
| Compound Name | (2S,3S,4aS,5S,6S,7S,8aS)-5-[tert-butyl(diphenyl)silyl]oxy-2,3-diphenyl-7-phenylselanyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-6-ol |
|---|---|
| PubChem CID | 102217004 |
| Molecular Formula | C42H44O4SeSi |
| Molecular Weight | 719.86 g/mol |
| Exact Mass | 720.22 |
| IUPAC Name | (2S,3S,4aS,5S,6S,7S,8aS)-5-[tert-butyl(diphenyl)silyl]oxy-2,3-diphenyl-7-phenylselanyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-6-ol |
| SMILES | CC(C)(C)[Si](O[C@H]1[C@H](O)[C@@H]([Se]c2ccccc2)C[C@@H]2O[C@@H](c3ccccc3)[C@H](c3ccccc3)O[C@H]12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H44O4SeSi/c1-42(2,3)48(33-25-15-7-16-26-33,34-27-17-8-18-28-34)46-41-37(43)36(47-32-23-13-6-14-24-32)29-35-40(41)45-39(31-21-11-5-12-22-31)38(44-35)30-19-9-4-10-20-30/h4-28,35-41,43H,29H2,1-3H3/t35-,36-,37+,38-,39-,40-,41-/m0/s1 |
| InChIKey | MYBUXRBJUGHTJC-MHNGZOTISA-N |
| XLogP | 6.78 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.86 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|