C23H30O2Si — CID 171553746
tert-butyl-(3-oxabicyclo[3.2.1]octan-8-yloxy)-diphenylsilane (PubChem CID 171553746) has the molecular formula C23H30O2Si and a molecular weight of 366.58 g/mol. Its IUPAC name is tert-butyl-(3-oxabicyclo[3.2.1]octan-8-yloxy)-diphenylsilane.
| Compound Name | tert-butyl-(3-oxabicyclo[3.2.1]octan-8-yloxy)-diphenylsilane |
|---|---|
| PubChem CID | 171553746 |
| Molecular Formula | C23H30O2Si |
| Molecular Weight | 366.58 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | tert-butyl-(3-oxabicyclo[3.2.1]octan-8-yloxy)-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC1C2CCC1COC2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30O2Si/c1-23(2,3)26(20-10-6-4-7-11-20,21-12-8-5-9-13-21)25-22-18-14-15-19(22)17-24-16-18/h4-13,18-19,22H,14-17H2,1-3H3 |
| InChIKey | NBPFAFZNBQLBCF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|