C20H27NOSi — CID 58393504
tert-butyl-diphenyl-[(3R)-pyrrolidin-3-yl]oxysilane (PubChem CID 58393504) has the molecular formula C20H27NOSi and a molecular weight of 325.53 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(3R)-pyrrolidin-3-yl]oxysilane.
| Compound Name | tert-butyl-diphenyl-[(3R)-pyrrolidin-3-yl]oxysilane |
|---|---|
| PubChem CID | 58393504 |
| Molecular Formula | C20H27NOSi |
| Molecular Weight | 325.53 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | tert-butyl-diphenyl-[(3R)-pyrrolidin-3-yl]oxysilane |
| SMILES | CC(C)(C)[Si](O[C@@H]1CCNC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H27NOSi/c1-20(2,3)23(18-10-6-4-7-11-18,19-12-8-5-9-13-19)22-17-14-15-21-16-17/h4-13,17,21H,14-16H2,1-3H3/t17-/m1/s1 |
| InChIKey | WZTJJHSTQOTADQ-QGZVFWFLSA-N |
| XLogP | 2.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|