C22H31NOSi — CID 177203387
[(3S)-azepan-3-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 177203387) has the molecular formula C22H31NOSi and a molecular weight of 353.58 g/mol. Its IUPAC name is [(3S)-azepan-3-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(3S)-azepan-3-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 177203387 |
| Molecular Formula | C22H31NOSi |
| Molecular Weight | 353.58 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | [(3S)-azepan-3-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](O[C@H]1CCCCNC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H31NOSi/c1-22(2,3)25(20-13-6-4-7-14-20,21-15-8-5-9-16-21)24-19-12-10-11-17-23-18-19/h4-9,13-16,19,23H,10-12,17-18H2,1-3H3/t19-/m0/s1 |
| InChIKey | PEROIOANEHNPFZ-IBGZPJMESA-N |
| XLogP | 3.71 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|