C24H32O2Si — CID 86594888
2-[(1S,3R)-3-[tert-butyl(diphenyl)silyl]oxycyclohexyl]acetaldehyde (PubChem CID 86594888) has the molecular formula C24H32O2Si and a molecular weight of 380.60 g/mol. Its IUPAC name is 2-[(1S,3R)-3-[tert-butyl(diphenyl)silyl]oxycyclohexyl]acetaldehyde.
| Compound Name | 2-[(1S,3R)-3-[tert-butyl(diphenyl)silyl]oxycyclohexyl]acetaldehyde |
|---|---|
| PubChem CID | 86594888 |
| Molecular Formula | C24H32O2Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 2-[(1S,3R)-3-[tert-butyl(diphenyl)silyl]oxycyclohexyl]acetaldehyde |
| SMILES | CC(C)(C)[Si](O[C@@H]1CCC[C@H](CC=O)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32O2Si/c1-24(2,3)27(22-13-6-4-7-14-22,23-15-8-5-9-16-23)26-21-12-10-11-20(19-21)17-18-25/h4-9,13-16,18,20-21H,10-12,17,19H2,1-3H3/t20-,21-/m1/s1 |
| InChIKey | HNJQIGJPLYPMPU-NHCUHLMSSA-N |
| XLogP | 4.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|