C23H30O3Si — CID 68922385
2-[(1S,2S)-2-[tert-butyl(diphenyl)silyl]oxycyclopentyl]acetic acid (PubChem CID 68922385) has the molecular formula C23H30O3Si and a molecular weight of 382.58 g/mol. Its IUPAC name is 2-[(1S,2S)-2-[tert-butyl(diphenyl)silyl]oxycyclopentyl]acetic acid.
| Compound Name | 2-[(1S,2S)-2-[tert-butyl(diphenyl)silyl]oxycyclopentyl]acetic acid |
|---|---|
| PubChem CID | 68922385 |
| Molecular Formula | C23H30O3Si |
| Molecular Weight | 382.58 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-[(1S,2S)-2-[tert-butyl(diphenyl)silyl]oxycyclopentyl]acetic acid |
| SMILES | CC(C)(C)[Si](O[C@H]1CCC[C@H]1CC(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30O3Si/c1-23(2,3)27(19-12-6-4-7-13-19,20-14-8-5-9-15-20)26-21-16-10-11-18(21)17-22(24)25/h4-9,12-15,18,21H,10-11,16-17H2,1-3H3,(H,24,25)/t18-,21-/m0/s1 |
| InChIKey | AQBYWBKSDFULPT-RXVVDRJESA-N |
| XLogP | 4.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|