C23H28O3Si — CID 171085570
2-[2-[tert-butyl(diphenyl)silyl]oxycyclopentyl]-2-oxoacetaldehyde (PubChem CID 171085570) has the molecular formula C23H28O3Si and a molecular weight of 380.56 g/mol. Its IUPAC name is 2-[2-[tert-butyl(diphenyl)silyl]oxycyclopentyl]-2-oxoacetaldehyde.
| Compound Name | 2-[2-[tert-butyl(diphenyl)silyl]oxycyclopentyl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 171085570 |
| Molecular Formula | C23H28O3Si |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 2-[2-[tert-butyl(diphenyl)silyl]oxycyclopentyl]-2-oxoacetaldehyde |
| SMILES | CC(C)(C)[Si](OC1CCCC1C(=O)C=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H28O3Si/c1-23(2,3)27(18-11-6-4-7-12-18,19-13-8-5-9-14-19)26-22-16-10-15-20(22)21(25)17-24/h4-9,11-14,17,20,22H,10,15-16H2,1-3H3 |
| InChIKey | JFGIPRPESMTWTQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|