C23H29NO3Si — CID 67033690
3-[tert-butyl(diphenyl)silyl]oxy-4-ethenylpyrrolidine-1-carboxylic acid (PubChem CID 67033690) has the molecular formula C23H29NO3Si and a molecular weight of 395.58 g/mol. Its IUPAC name is 3-[tert-butyl(diphenyl)silyl]oxy-4-ethenylpyrrolidine-1-carboxylic acid.
| Compound Name | 3-[tert-butyl(diphenyl)silyl]oxy-4-ethenylpyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67033690 |
| Molecular Formula | C23H29NO3Si |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 3-[tert-butyl(diphenyl)silyl]oxy-4-ethenylpyrrolidine-1-carboxylic acid |
| SMILES | C=CC1CN(C(=O)O)CC1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H29NO3Si/c1-5-18-16-24(22(25)26)17-21(18)27-28(23(2,3)4,19-12-8-6-9-13-19)20-14-10-7-11-15-20/h5-15,18,21H,1,16-17H2,2-4H3,(H,25,26) |
| InChIKey | DFBJWDABZHRYPU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|