C22H28O3Si — CID 177365841
trans-(1R,2R)-2-[tert-butyl(diphenyl)silyl]oxycyclopentane-1-carboxylic acid (PubChem CID 177365841) has the molecular formula C22H28O3Si and a molecular weight of 368.55 g/mol. Its IUPAC name is trans-(1R,2R)-2-[tert-butyl(diphenyl)silyl]oxycyclopentane-1-carboxylic acid.
| Compound Name | trans-(1R,2R)-2-[tert-butyl(diphenyl)silyl]oxycyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 177365841 |
| Molecular Formula | C22H28O3Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | trans-(1R,2R)-2-[tert-butyl(diphenyl)silyl]oxycyclopentane-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](O[C@@H]1CCC[C@H]1C(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28O3Si/c1-22(2,3)26(17-11-6-4-7-12-17,18-13-8-5-9-14-18)25-20-16-10-15-19(20)21(23)24/h4-9,11-14,19-20H,10,15-16H2,1-3H3,(H,23,24)/t19-,20-/m1/s1 |
| InChIKey | ZTIXXDMEQOQKMB-WOJBJXKFSA-N |
| XLogP | 3.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|