C24H32O3Si — CID 68920543
2-[2-[tert-butyl(diphenyl)silyl]oxycyclohexyl]acetic acid (PubChem CID 68920543) has the molecular formula C24H32O3Si and a molecular weight of 396.60 g/mol. Its IUPAC name is 2-[2-[tert-butyl(diphenyl)silyl]oxycyclohexyl]acetic acid.
| Compound Name | 2-[2-[tert-butyl(diphenyl)silyl]oxycyclohexyl]acetic acid |
|---|---|
| PubChem CID | 68920543 |
| Molecular Formula | C24H32O3Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 2-[2-[tert-butyl(diphenyl)silyl]oxycyclohexyl]acetic acid |
| SMILES | CC(C)(C)[Si](OC1CCCCC1CC(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32O3Si/c1-24(2,3)28(20-13-6-4-7-14-20,21-15-8-5-9-16-21)27-22-17-11-10-12-19(22)18-23(25)26/h4-9,13-16,19,22H,10-12,17-18H2,1-3H3,(H,25,26) |
| InChIKey | WJFIITLQRYJPMU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|