C26H36O3Si — CID 69240889
4-[(1R,3R)-3-[tert-butyl(diphenyl)silyl]oxycyclohexyl]butanoic acid (PubChem CID 69240889) has the molecular formula C26H36O3Si and a molecular weight of 424.66 g/mol. Its IUPAC name is 4-[(1R,3R)-3-[tert-butyl(diphenyl)silyl]oxycyclohexyl]butanoic acid.
| Compound Name | 4-[(1R,3R)-3-[tert-butyl(diphenyl)silyl]oxycyclohexyl]butanoic acid |
|---|---|
| PubChem CID | 69240889 |
| Molecular Formula | C26H36O3Si |
| Molecular Weight | 424.66 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 4-[(1R,3R)-3-[tert-butyl(diphenyl)silyl]oxycyclohexyl]butanoic acid |
| SMILES | CC(C)(C)[Si](O[C@@H]1CCC[C@H](CCCC(=O)O)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H36O3Si/c1-26(2,3)30(23-15-6-4-7-16-23,24-17-8-5-9-18-24)29-22-14-10-12-21(20-22)13-11-19-25(27)28/h4-9,15-18,21-22H,10-14,19-20H2,1-3H3,(H,27,28)/t21-,22-/m1/s1 |
| InChIKey | LPQLTXLFEDPGQN-FGZHOGPDSA-N |
| XLogP | 5.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.66 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|