C32H48O3Si — CID 69241608
tert-butyl 4-[(1R,3R)-3-[tert-butyl(diphenyl)silyl]oxycyclohexyl]-2,2-dimethylbutanoate (PubChem CID 69241608) has the molecular formula C32H48O3Si and a molecular weight of 508.82 g/mol. Its IUPAC name is tert-butyl 4-[(1R,3R)-3-[tert-butyl(diphenyl)silyl]oxycyclohexyl]-2,2-dimethylbutanoate.
| Compound Name | tert-butyl 4-[(1R,3R)-3-[tert-butyl(diphenyl)silyl]oxycyclohexyl]-2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 69241608 |
| Molecular Formula | C32H48O3Si |
| Molecular Weight | 508.82 g/mol |
| Exact Mass | 508.34 |
| IUPAC Name | tert-butyl 4-[(1R,3R)-3-[tert-butyl(diphenyl)silyl]oxycyclohexyl]-2,2-dimethylbutanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(C)CC[C@H]1CCC[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C32H48O3Si/c1-30(2,3)34-29(33)32(7,8)23-22-25-16-15-17-26(24-25)35-36(31(4,5)6,27-18-11-9-12-19-27)28-20-13-10-14-21-28/h9-14,18-21,25-26H,15-17,22-24H2,1-8H3/t25-,26-/m1/s1 |
| InChIKey | XBMDTKNKTAJHTJ-CLJLJLNGSA-N |
| XLogP | 7.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.82 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|