C30H44O4Si — CID 71171552
tert-butyl 2-[[(1S,3S)-3-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]cyclohexyl]methoxy]acetate (PubChem CID 71171552) has the molecular formula C30H44O4Si and a molecular weight of 496.76 g/mol. Its IUPAC name is tert-butyl 2-[[(1S,3S)-3-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]cyclohexyl]methoxy]acetate.
| Compound Name | tert-butyl 2-[[(1S,3S)-3-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]cyclohexyl]methoxy]acetate |
|---|---|
| PubChem CID | 71171552 |
| Molecular Formula | C30H44O4Si |
| Molecular Weight | 496.76 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | tert-butyl 2-[[(1S,3S)-3-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]cyclohexyl]methoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COC[C@H]1CCC[C@@H](CCC(C)(C)[Si](O)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C30H44O4Si/c1-29(2,3)34-28(31)23-33-22-25-14-12-13-24(21-25)19-20-30(4,5)35(32,26-15-8-6-9-16-26)27-17-10-7-11-18-27/h6-11,15-18,24-25,32H,12-14,19-23H2,1-5H3/t24-,25-/m0/s1 |
| InChIKey | UXZNGHBWKVBXHW-DQEYMECFSA-N |
| XLogP | 5.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.76 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|