C30H45NO3Si — CID 161390684
tert-butyl N-[2-[(3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentyl]propan-2-yl]carbamate (PubChem CID 161390684) has the molecular formula C30H45NO3Si and a molecular weight of 495.78 g/mol. Its IUPAC name is tert-butyl N-[2-[(3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-[(3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 161390684 |
| Molecular Formula | C30H45NO3Si |
| Molecular Weight | 495.78 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | tert-butyl N-[2-[(3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentyl]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)C1CC[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C30H45NO3Si/c1-28(2,3)34-27(32)31-30(7,8)24-20-19-23(21-24)22-33-35(29(4,5)6,25-15-11-9-12-16-25)26-17-13-10-14-18-26/h9-18,23-24H,19-22H2,1-8H3,(H,31,32)/t23-,24?/m0/s1 |
| InChIKey | VSYHNWMJMURNKZ-UXMRNZNESA-N |
| XLogP | 6.28 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.78 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|