C23H29NOSi — CID 159922386
tert-butyl-[[(1S)-3-isocyanocyclopentyl]methoxy]-diphenylsilane (PubChem CID 159922386) has the molecular formula C23H29NOSi and a molecular weight of 363.58 g/mol. Its IUPAC name is tert-butyl-[[(1S)-3-isocyanocyclopentyl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(1S)-3-isocyanocyclopentyl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 159922386 |
| Molecular Formula | C23H29NOSi |
| Molecular Weight | 363.58 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | tert-butyl-[[(1S)-3-isocyanocyclopentyl]methoxy]-diphenylsilane |
| SMILES | [C-]#[N+]C1CC[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C23H29NOSi/c1-23(2,3)26(21-11-7-5-8-12-21,22-13-9-6-10-14-22)25-18-19-15-16-20(17-19)24-4/h5-14,19-20H,15-18H2,1-3H3/t19-,20?/m0/s1 |
| InChIKey | NYOMFLMRWTYVCR-XJDOXCRVSA-N |
| XLogP | 4.65 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|