C26H31NO3Si — CID 164667100
7-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(hydroxymethyl)-5-isocyanobicyclo[2.2.1]heptan-2-one (PubChem CID 164667100) has the molecular formula C26H31NO3Si and a molecular weight of 433.62 g/mol. Its IUPAC name is 7-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(hydroxymethyl)-5-isocyanobicyclo[2.2.1]heptan-2-one.
| Compound Name | 7-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(hydroxymethyl)-5-isocyanobicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 164667100 |
| Molecular Formula | C26H31NO3Si |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 7-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(hydroxymethyl)-5-isocyanobicyclo[2.2.1]heptan-2-one |
| SMILES | [C-]#[N+]C1CC2C(=O)CC1(CO)C2CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H31NO3Si/c1-25(2,3)31(19-11-7-5-8-12-19,20-13-9-6-10-14-20)30-17-22-21-15-24(27-4)26(22,18-28)16-23(21)29/h5-14,21-22,24,28H,15-18H2,1-3H3 |
| InChIKey | NNYKKQHDGVNUNB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|