C21H28O2Si — CID 174251063
(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclobutan-1-ol (PubChem CID 174251063) has the molecular formula C21H28O2Si and a molecular weight of 340.54 g/mol. Its IUPAC name is (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclobutan-1-ol.
| Compound Name | (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 174251063 |
| Molecular Formula | C21H28O2Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclobutan-1-ol |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CCC1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28O2Si/c1-21(2,3)24(18-10-6-4-7-11-18,19-12-8-5-9-13-19)23-16-17-14-15-20(17)22/h4-13,17,20,22H,14-16H2,1-3H3/t17-,20?/m0/s1 |
| InChIKey | MLJYAMGTLRVBEO-DIMJTDRSSA-N |
| XLogP | 3.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|